Other Solvents
Filtered Search Results
M-Xylene, Certified Reference Material, MilliporeSigma™ Supelco™
Pharmaceutical secondary standards for application in quality control. Provides pharma laboratories and manufacturers with a convenient, and cost-effective alternative to the preparation of in-house working standards.
1,4-Dioxane, Certified Reference Material, MilliporeSigma™ Supelco™
Pharmaceutical secondary standards for application in quality control. Provides pharma laboratories and manufacturers with a convenient, and cost-effective alternative to the preparation of in-house working standards.
N,N-Dimethylacetamide-d{9}, 99% (Isotopic)
CAS: 116057-81-9 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00066061 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: n,n-dimethylacetamide-d9,n,n-bis ∼2∼h_3_ methyl ∼2∼h_3_ acetamide,an,n-dimethylacetamide-d9,n,n-dimethylacetamide-d9, 99 atom % d,n,n-bis 2 h? methyl 2 h? acetamide,n,n-di 2 h? methyl 2 h? acetamide PubChem CID: 22789542 SMILES: CN(C)C(C)=O
| PubChem CID | 22789542 |
|---|---|
| CAS | 116057-81-9 |
| Molecular Weight (g/mol) | 87.12 |
| MDL Number | MFCD00066061 |
| SMILES | CN(C)C(C)=O |
| Synonym | n,n-dimethylacetamide-d9,n,n-bis ∼2∼h_3_ methyl ∼2∼h_3_ acetamide,an,n-dimethylacetamide-d9,n,n-dimethylacetamide-d9, 99 atom % d,n,n-bis 2 h? methyl 2 h? acetamide,n,n-di 2 h? methyl 2 h? acetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
L-Lactide, 98%, Thermo Scientific Chemicals
CAS: 4511-42-6 Molecular Formula: C6H8O4 Molecular Weight (g/mol): 144.13 MDL Number: MFCD00070594 InChI Key: JJTUDXZGHPGLLC-UHFFFAOYNA-N Synonym: l-lactide,3s,6s-3,6-dimethyl-1,4-dioxane-2,5-dione,l---lactide,lactide, l,l-dilactide,3s-cis-3,6-dimethyl-1,4-dioxane-2,5-dione,ll-lactide,unii-ij13to4no1,1,4-dioxane-2,5-dione, 3,6-dimethyl-, 3s,6s,ij13to4no1 PubChem CID: 107983 IUPAC Name: (3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione SMILES: CC1OC(=O)C(C)OC1=O
| PubChem CID | 107983 |
|---|---|
| CAS | 4511-42-6 |
| Molecular Weight (g/mol) | 144.13 |
| MDL Number | MFCD00070594 |
| SMILES | CC1OC(=O)C(C)OC1=O |
| Synonym | l-lactide,3s,6s-3,6-dimethyl-1,4-dioxane-2,5-dione,l---lactide,lactide, l,l-dilactide,3s-cis-3,6-dimethyl-1,4-dioxane-2,5-dione,ll-lactide,unii-ij13to4no1,1,4-dioxane-2,5-dione, 3,6-dimethyl-, 3s,6s,ij13to4no1 |
| IUPAC Name | (3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione |
| InChI Key | JJTUDXZGHPGLLC-UHFFFAOYNA-N |
| Molecular Formula | C6H8O4 |
Chlorobenzene, 99+%, for spectroscopy
CAS: 108-90-7 Molecular Formula: C6H5Cl Molecular Weight (g/mol): 112.556 MDL Number: MFCD00000530 InChI Key: MVPPADPHJFYWMZ-UHFFFAOYSA-N Synonym: monochlorobenzene,benzene chloride,phenyl chloride,benzene, chloro,chlorbenzene,chlorobenzol,monochlorbenzol,chlorbenzol,chlorobenzen,clorobenzene PubChem CID: 7964 ChEBI: CHEBI:28097 IUPAC Name: chlorobenzene SMILES: C1=CC=C(C=C1)Cl
| PubChem CID | 7964 |
|---|---|
| CAS | 108-90-7 |
| Molecular Weight (g/mol) | 112.556 |
| ChEBI | CHEBI:28097 |
| MDL Number | MFCD00000530 |
| SMILES | C1=CC=C(C=C1)Cl |
| Synonym | monochlorobenzene,benzene chloride,phenyl chloride,benzene, chloro,chlorbenzene,chlorobenzol,monochlorbenzol,chlorbenzol,chlorobenzen,clorobenzene |
| IUPAC Name | chlorobenzene |
| InChI Key | MVPPADPHJFYWMZ-UHFFFAOYSA-N |
| Molecular Formula | C6H5Cl |
2,5-Dimethylbenzenesulfonyl chloride, 98%, Thermo Scientific™
CAS: 19040-62-1 Molecular Formula: C8H9ClO2S Molecular Weight (g/mol): 204.668 MDL Number: MFCD00024875 InChI Key: FZVZUIBYLZZOEW-UHFFFAOYSA-N Synonym: p-xylene-2-sulfonyl chloride,benzenesulfonyl chloride, 2,5-dimethyl,2,5-dimethylbenzene-1-sulfonyl chloride,2,5-dimethylphenylsulfonyl chloride,2,5-dimethyl-benzenesulfonyl chloride,benzenesulfonylchloride, 2,5-dimethyl,2,5-dimethylphenyl chlorosulfone,acmc-209etq,xylenesulfonylchloride,ksc178m0f PubChem CID: 87910 IUPAC Name: 2,5-dimethylbenzenesulfonyl chloride SMILES: CC1=CC(=C(C=C1)C)S(=O)(=O)Cl
| PubChem CID | 87910 |
|---|---|
| CAS | 19040-62-1 |
| Molecular Weight (g/mol) | 204.668 |
| MDL Number | MFCD00024875 |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)Cl |
| Synonym | p-xylene-2-sulfonyl chloride,benzenesulfonyl chloride, 2,5-dimethyl,2,5-dimethylbenzene-1-sulfonyl chloride,2,5-dimethylphenylsulfonyl chloride,2,5-dimethyl-benzenesulfonyl chloride,benzenesulfonylchloride, 2,5-dimethyl,2,5-dimethylphenyl chlorosulfone,acmc-209etq,xylenesulfonylchloride,ksc178m0f |
| IUPAC Name | 2,5-dimethylbenzenesulfonyl chloride |
| InChI Key | FZVZUIBYLZZOEW-UHFFFAOYSA-N |
| Molecular Formula | C8H9ClO2S |
(S)-(+)-2-Butanol, 98+%
Molecular Formula: C4H10O Molecular Weight (g/mol): 74.123 MDL Number: MFCD00064281 InChI Key: BTANRVKWQNVYAZ-BYPYZUCNSA-N Synonym: s-+-2-butanol,s-2-butanol,2s-butan-2-ol,s-butan-2-ol,s-+-sec-butanol,2s-2-butanol,unii-69kxu5ndto,s---2-butanol,s-+-sec-butyl alcohol PubChem CID: 444683 ChEBI: CHEBI:45475 IUPAC Name: (2S)-butan-2-ol SMILES: CCC(C)O
| PubChem CID | 444683 |
|---|---|
| Molecular Weight (g/mol) | 74.123 |
| ChEBI | CHEBI:45475 |
| MDL Number | MFCD00064281 |
| SMILES | CCC(C)O |
| Synonym | s-+-2-butanol,s-2-butanol,2s-butan-2-ol,s-butan-2-ol,s-+-sec-butanol,2s-2-butanol,unii-69kxu5ndto,s---2-butanol,s-+-sec-butyl alcohol |
| IUPAC Name | (2S)-butan-2-ol |
| InChI Key | BTANRVKWQNVYAZ-BYPYZUCNSA-N |
| Molecular Formula | C4H10O |
N,N-Dimethylacetamide, 99+%, for spectroscopy
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
Xylenes, 96%, pure, mixed isomers with ethylbenzene
CAS: 1330-20-7 Molecular Formula: C8H10 MDL Number: MFCD00077264 Synonym: Dimethylbenzene
| CAS | 1330-20-7 |
|---|---|
| MDL Number | MFCD00077264 |
| Synonym | Dimethylbenzene |
| Molecular Formula | C8H10 |
Methanol-d3, for NMR, 99.5 atom % D
CAS: 1849-29-2 Molecular Formula: CH4O Molecular Weight (g/mol): 35.06 MDL Number: MFCD00055877 InChI Key: OKKJLVBELUTLKV-FIBGUPNXSA-N Synonym: methanol-d3,methan-d3-ol,2h3 methanol,methyl-d3 alcohol,methan-d3-ol 6ci,7ci,8ci,9ci,cd3oh,1,1,1-trideuteromethanol,methanol d,1,1,1-2h3 methanol,methanol-d3, 99.8 atom % d PubChem CID: 123132 IUPAC Name: trideuteriomethanol SMILES: CO
| PubChem CID | 123132 |
|---|---|
| CAS | 1849-29-2 |
| Molecular Weight (g/mol) | 35.06 |
| MDL Number | MFCD00055877 |
| SMILES | CO |
| Synonym | methanol-d3,methan-d3-ol,2h3 methanol,methyl-d3 alcohol,methan-d3-ol 6ci,7ci,8ci,9ci,cd3oh,1,1,1-trideuteromethanol,methanol d,1,1,1-2h3 methanol,methanol-d3, 99.8 atom % d |
| IUPAC Name | trideuteriomethanol |
| InChI Key | OKKJLVBELUTLKV-FIBGUPNXSA-N |
| Molecular Formula | CH4O |
Nitromethane-d3, for NMR, 99 atom % D
CAS: 13031-32-8 Molecular Formula: CH3NO2 Molecular Weight (g/mol): 64.06 MDL Number: MFCD00044214 InChI Key: LYGJENNIWJXYER-FIBGUPNXSA-N Synonym: nitromethane-d3,nitro 2h3 methane,nitro 2 h? methane,nitromethane-d3, 99 atom % d,methane-d3, nitro,cd3no2,trideuteronitromethane,methane-d3-, nitro,nitromethane-d3, ≥99 atom % d, contains 1 % v/v tms PubChem CID: 123293 IUPAC Name: trideuterio(nitro)methane SMILES: [2H]C([2H])([2H])[N+]([O-])=O
| PubChem CID | 123293 |
|---|---|
| CAS | 13031-32-8 |
| Molecular Weight (g/mol) | 64.06 |
| MDL Number | MFCD00044214 |
| SMILES | [2H]C([2H])([2H])[N+]([O-])=O |
| Synonym | nitromethane-d3,nitro 2h3 methane,nitro 2 h? methane,nitromethane-d3, 99 atom % d,methane-d3, nitro,cd3no2,trideuteronitromethane,methane-d3-, nitro,nitromethane-d3, ≥99 atom % d, contains 1 % v/v tms |
| IUPAC Name | trideuterio(nitro)methane |
| InChI Key | LYGJENNIWJXYER-FIBGUPNXSA-N |
| Molecular Formula | CH3NO2 |
Methyl sulfoxide-d6, for NMR, 99+ atom % D
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: trideuterio(trideuteriomethylsulfinyl)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | trideuterio(trideuteriomethylsulfinyl)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
Toluene-d8, for NMR, 100.0 atom % D
CAS: 2037-26-5 Molecular Formula: C7H8 Molecular Weight (g/mol): 100.19 InChI Key: YXFVVABEGXRONW-JGUCLWPXSA-N Synonym: toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d PubChem CID: 74861 IUPAC Name: 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene SMILES: CC1=CC=CC=C1
| PubChem CID | 74861 |
|---|---|
| CAS | 2037-26-5 |
| Molecular Weight (g/mol) | 100.19 |
| SMILES | CC1=CC=CC=C1 |
| Synonym | toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene |
| InChI Key | YXFVVABEGXRONW-JGUCLWPXSA-N |
| Molecular Formula | C7H8 |
N,N-Dimethylformamide, 99.5%, for analysis
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
Deuterium chloride, for NMR, 20 wt. % solution in D2O, 99+ atom % D
CAS: 7698-05-7 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00044642 InChI Key: VEXZGXHMUGYJMC-FTGQXOHASA-N Synonym: deuterium chloride,hydrochloric acid-d,deuterium chloride, 20 wt% in deuterium oxide,chlorohydrogen,hydrochloric acid d,chloro 2h,deuterium chloride, 99 atom % d,deuterium chloride, 1 m in deuterium oxide,deuterium chloride, 0.1 m in deuterium oxide,deuterium chloride, 38 wt% in deuterium oxide PubChem CID: 522634 SMILES: Cl
| PubChem CID | 522634 |
|---|---|
| CAS | 7698-05-7 |
| Molecular Weight (g/mol) | 36.46 |
| MDL Number | MFCD00044642 |
| SMILES | Cl |
| Synonym | deuterium chloride,hydrochloric acid-d,deuterium chloride, 20 wt% in deuterium oxide,chlorohydrogen,hydrochloric acid d,chloro 2h,deuterium chloride, 99 atom % d,deuterium chloride, 1 m in deuterium oxide,deuterium chloride, 0.1 m in deuterium oxide,deuterium chloride, 38 wt% in deuterium oxide |
| InChI Key | VEXZGXHMUGYJMC-FTGQXOHASA-N |
| Molecular Formula | ClH |